C8H11Cl — CID 130391076
(5R)-2-chloro-1,5-dimethylcyclohexa-1,3-diene (PubChem CID 130391076) has the molecular formula C8H11Cl and a molecular weight of 142.63 g/mol. Its IUPAC name is (5R)-2-chloro-1,5-dimethylcyclohexa-1,3-diene.
| Compound Name | (5R)-2-chloro-1,5-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 130391076 |
| Molecular Formula | C8H11Cl |
| Molecular Weight | 142.63 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | (5R)-2-chloro-1,5-dimethylcyclohexa-1,3-diene |
| SMILES | CC1=C(Cl)C=C[C@H](C)C1 |
| InChI | InChI=1S/C8H11Cl/c1-6-3-4-8(9)7(2)5-6/h3-4,6H,5H2,1-2H3/t6-/m0/s1 |
| InChIKey | VOPBUDWRSXIPPZ-LURJTMIESA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |