C10H13N — CID 162195264
2,5-dimethyl-4,5-dihydro-3H-indole (PubChem CID 162195264) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,5-dimethyl-4,5-dihydro-3H-indole.
| Compound Name | 2,5-dimethyl-4,5-dihydro-3H-indole |
|---|---|
| PubChem CID | 162195264 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2,5-dimethyl-4,5-dihydro-3H-indole |
| SMILES | CC1=NC2=C(C1)CC(C)C=C2 |
| InChI | InChI=1S/C10H13N/c1-7-3-4-10-9(5-7)6-8(2)11-10/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | ZBSLWHUFYLJEPR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |