About 2,5-dimethyl-4,5-dihydro-3H-indole
2,5-dimethyl-4,5-dihydro-3H-indole (PubChem CID 162195264) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,5-dimethyl-4,5-dihydro-3H-indole.
Molecular Properties
| Compound Name | 2,5-dimethyl-4,5-dihydro-3H-indole |
| PubChem CID | 162195264 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2,5-dimethyl-4,5-dihydro-3H-indole |
| SMILES | CC1=NC2=C(C1)CC(C)C=C2 |
| InChI | InChI=1S/C10H13N/c1-7-3-4-10-9(5-7)6-8(2)11-10/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | ZBSLWHUFYLJEPR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethyl-4,5-dihydro-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4,5-dihydro-3H-indole?
The IUPAC name of 2,5-dimethyl-4,5-dihydro-3H-indole (CID 162195264) is 2,5-dimethyl-4,5-dihydro-3H-indole.
What is the SMILES notation for 2,5-dimethyl-4,5-dihydro-3H-indole?
The canonical SMILES for 2,5-dimethyl-4,5-dihydro-3H-indole is CC1=NC2=C(C1)CC(C)C=C2.
What is the InChIKey of 2,5-dimethyl-4,5-dihydro-3H-indole?
The InChIKey is ZBSLWHUFYLJEPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-7-3-4-10-9(5-7)6-8(2)11-10/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 2,5-dimethyl-4,5-dihydro-3H-indole?
2,5-dimethyl-4,5-dihydro-3H-indole has a molecular weight of 147.22 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4,5-dihydro-3H-indole is sourced from PubChem (CID 162195264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).