C9H20NP — CID 143344740
(2,4-dimethylcyclohexa-1,5-dien-1-yl)phosphane;methanamine;molecular hydrogen (PubChem CID 143344740) has the molecular formula C9H20NP and a molecular weight of 173.24 g/mol. Its IUPAC name is (2,4-dimethylcyclohexa-1,5-dien-1-yl)phosphane;methanamine;molecular hydrogen.
| Compound Name | (2,4-dimethylcyclohexa-1,5-dien-1-yl)phosphane;methanamine;molecular hydrogen |
|---|---|
| PubChem CID | 143344740 |
| Molecular Formula | C9H20NP |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.13 |
| IUPAC Name | (2,4-dimethylcyclohexa-1,5-dien-1-yl)phosphane;methanamine;molecular hydrogen |
| SMILES | CC1=C(P)C=CC(C)C1.CN.[H][H] |
| InChI | InChI=1S/C8H13P.CH5N.H2/c1-6-3-4-8(9)7(2)5-6;1-2;/h3-4,6H,5,9H2,1-2H3;2H2,1H3;1H |
| InChIKey | GYEOCLQBURBAIK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|