C14H20 — CID 142943759
2,7-dimethyl-1,2-dihydronaphthalene;ethane (PubChem CID 142943759) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 2,7-dimethyl-1,2-dihydronaphthalene;ethane.
| Compound Name | 2,7-dimethyl-1,2-dihydronaphthalene;ethane |
|---|---|
| PubChem CID | 142943759 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 2,7-dimethyl-1,2-dihydronaphthalene;ethane |
| SMILES | CC.Cc1ccc2c(c1)CC(C)C=C2 |
| InChI | InChI=1S/C12H14.C2H6/c1-9-3-5-11-6-4-10(2)8-12(11)7-9;1-2/h3-7,10H,8H2,1-2H3;1-2H3 |
| InChIKey | PHMQHPIMPIQKGG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |