C13H19N — CID 139325985
(2S,3R)-1,2,3,6-tetramethyl-3,4-dihydro-2H-quinoline (PubChem CID 139325985) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (2S,3R)-1,2,3,6-tetramethyl-3,4-dihydro-2H-quinoline.
| Compound Name | (2S,3R)-1,2,3,6-tetramethyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 139325985 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (2S,3R)-1,2,3,6-tetramethyl-3,4-dihydro-2H-quinoline |
| SMILES | Cc1ccc2c(c1)C[C@@H](C)[C@H](C)N2C |
| InChI | InChI=1S/C13H19N/c1-9-5-6-13-12(7-9)8-10(2)11(3)14(13)4/h5-7,10-11H,8H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | XUHVIPBQKLENGT-MNOVXSKESA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |