C19H26N2 — CID 162173343
N,N-dimethylmethanamine;2,7,10-trimethyl-9H-acridine (PubChem CID 162173343) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2,7,10-trimethyl-9H-acridine.
| Compound Name | N,N-dimethylmethanamine;2,7,10-trimethyl-9H-acridine |
|---|---|
| PubChem CID | 162173343 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N,N-dimethylmethanamine;2,7,10-trimethyl-9H-acridine |
| SMILES | CN(C)C.Cc1ccc2c(c1)Cc1cc(C)ccc1N2C |
| InChI | InChI=1S/C16H17N.C3H9N/c1-11-4-6-15-13(8-11)10-14-9-12(2)5-7-16(14)17(15)3;1-4(2)3/h4-9H,10H2,1-3H3;1-3H3 |
| InChIKey | ZOBMZQJXXPXBDM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |