C14H21N — CID 144701726
(2S)-6-ethyl-1,2,3-trimethyl-3,4-dihydro-2H-quinoline (PubChem CID 144701726) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (2S)-6-ethyl-1,2,3-trimethyl-3,4-dihydro-2H-quinoline.
| Compound Name | (2S)-6-ethyl-1,2,3-trimethyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 144701726 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (2S)-6-ethyl-1,2,3-trimethyl-3,4-dihydro-2H-quinoline |
| SMILES | CCc1ccc2c(c1)CC(C)[C@H](C)N2C |
| InChI | InChI=1S/C14H21N/c1-5-12-6-7-14-13(9-12)8-10(2)11(3)15(14)4/h6-7,9-11H,5,8H2,1-4H3/t10?,11-/m0/s1 |
| InChIKey | RITIGDXGAROKRQ-DTIOYNMSSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |