C15H23N3 — CID 117203229
1,2-dimethyl-5-(piperazin-1-ylmethyl)-2,3-dihydroindole (PubChem CID 117203229) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 1,2-dimethyl-5-(piperazin-1-ylmethyl)-2,3-dihydroindole.
| Compound Name | 1,2-dimethyl-5-(piperazin-1-ylmethyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 117203229 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 1,2-dimethyl-5-(piperazin-1-ylmethyl)-2,3-dihydroindole |
| SMILES | CC1Cc2cc(CN3CCNCC3)ccc2N1C |
| InChI | InChI=1S/C15H23N3/c1-12-9-14-10-13(3-4-15(14)17(12)2)11-18-7-5-16-6-8-18/h3-4,10,12,16H,5-9,11H2,1-2H3 |
| InChIKey | PJACFFJHMHIXPU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|