C13H17NO2 — CID 84623301
6-ethyl-1-methyl-3,4-dihydro-2H-quinoline-2-carboxylic acid (PubChem CID 84623301) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 6-ethyl-1-methyl-3,4-dihydro-2H-quinoline-2-carboxylic acid.
| Compound Name | 6-ethyl-1-methyl-3,4-dihydro-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 84623301 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 6-ethyl-1-methyl-3,4-dihydro-2H-quinoline-2-carboxylic acid |
| SMILES | CCc1ccc2c(c1)CCC(C(=O)O)N2C |
| InChI | InChI=1S/C13H17NO2/c1-3-9-4-6-11-10(8-9)5-7-12(13(15)16)14(11)2/h4,6,8,12H,3,5,7H2,1-2H3,(H,15,16) |
| InChIKey | KQXQFIYAPSZOQH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |