C15H18N2O2 — CID 134499367
1-(2-cyano-4-ethylphenyl)piperidine-4-carboxylic acid (PubChem CID 134499367) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-(2-cyano-4-ethylphenyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(2-cyano-4-ethylphenyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 134499367 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-(2-cyano-4-ethylphenyl)piperidine-4-carboxylic acid |
| SMILES | CCc1ccc(N2CCC(C(=O)O)CC2)c(C#N)c1 |
| InChI | InChI=1S/C15H18N2O2/c1-2-11-3-4-14(13(9-11)10-16)17-7-5-12(6-8-17)15(18)19/h3-4,9,12H,2,5-8H2,1H3,(H,18,19) |
| InChIKey | VITMSZZLDHEERK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |