C14H23NO — CID 91294862
ethane;2,3,4,7-tetramethyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 91294862) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is ethane;2,3,4,7-tetramethyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | ethane;2,3,4,7-tetramethyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 91294862 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | ethane;2,3,4,7-tetramethyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CC.Cc1ccc2c(c1)OC(C)C(C)N2C |
| InChI | InChI=1S/C12H17NO.C2H6/c1-8-5-6-11-12(7-8)14-10(3)9(2)13(11)4;1-2/h5-7,9-10H,1-4H3;1-2H3 |
| InChIKey | ABEAYBGFDNAOEZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |