C17H17N — CID 57298321
(4bS,9bR)-5,8-dimethyl-9b,10-dihydro-4bH-indeno[1,2-b]indole (PubChem CID 57298321) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is (4bS,9bR)-5,8-dimethyl-9b,10-dihydro-4bH-indeno[1,2-b]indole.
| Compound Name | (4bS,9bR)-5,8-dimethyl-9b,10-dihydro-4bH-indeno[1,2-b]indole |
|---|---|
| PubChem CID | 57298321 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (4bS,9bR)-5,8-dimethyl-9b,10-dihydro-4bH-indeno[1,2-b]indole |
| SMILES | Cc1ccc2c(c1)[C@H]1Cc3ccccc3[C@H]1N2C |
| InChI | InChI=1S/C17H17N/c1-11-7-8-16-14(9-11)15-10-12-5-3-4-6-13(12)17(15)18(16)2/h3-9,15,17H,10H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | CNEUKIJAWAXLTQ-NVXWUHKLSA-N |
| XLogP | 3.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_indane(1)', 'substructure': 'N/A'} |
|---|