C23H21N — CID 164681332
(4bR,10S,10aS)-5-methyl-10-phenyl-4b,10,10a,11-tetrahydroindeno[1,2-b]quinoline (PubChem CID 164681332) has the molecular formula C23H21N and a molecular weight of 311.43 g/mol. Its IUPAC name is (4bR,10S,10aS)-5-methyl-10-phenyl-4b,10,10a,11-tetrahydroindeno[1,2-b]quinoline.
| Compound Name | (4bR,10S,10aS)-5-methyl-10-phenyl-4b,10,10a,11-tetrahydroindeno[1,2-b]quinoline |
|---|---|
| PubChem CID | 164681332 |
| Molecular Formula | C23H21N |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (4bR,10S,10aS)-5-methyl-10-phenyl-4b,10,10a,11-tetrahydroindeno[1,2-b]quinoline |
| SMILES | CN1c2ccccc2[C@H](c2ccccc2)[C@@H]2Cc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C23H21N/c1-24-21-14-8-7-13-19(21)22(16-9-3-2-4-10-16)20-15-17-11-5-6-12-18(17)23(20)24/h2-14,20,22-23H,15H2,1H3/t20-,22-,23-/m0/s1 |
| InChIKey | VLNMCEDTFTXGOO-PMVMPFDFSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |