C17H17NS — CID 167260143
2-methyl-5-methylsulfanyl-6,10b-dihydro-5aH-indeno[2,1-b]indole (PubChem CID 167260143) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-methyl-5-methylsulfanyl-6,10b-dihydro-5aH-indeno[2,1-b]indole.
| Compound Name | 2-methyl-5-methylsulfanyl-6,10b-dihydro-5aH-indeno[2,1-b]indole |
|---|---|
| PubChem CID | 167260143 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-methyl-5-methylsulfanyl-6,10b-dihydro-5aH-indeno[2,1-b]indole |
| SMILES | CSN1c2ccc(C)cc2C2c3ccccc3CC21 |
| InChI | InChI=1S/C17H17NS/c1-11-7-8-15-14(9-11)17-13-6-4-3-5-12(13)10-16(17)18(15)19-2/h3-9,16-17H,10H2,1-2H3 |
| InChIKey | RFOBPYZEKPDYOX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|