C21H24N4S — CID 90379180
1-[(E)-(6,9-dimethyl-3,4,4a,9a-tetrahydro-2H-carbazol-1-ylidene)amino]-3-phenylthiourea (PubChem CID 90379180) has the molecular formula C21H24N4S and a molecular weight of 364.52 g/mol. Its IUPAC name is 1-[(E)-(6,9-dimethyl-3,4,4a,9a-tetrahydro-2H-carbazol-1-ylidene)amino]-3-phenylthiourea.
| Compound Name | 1-[(E)-(6,9-dimethyl-3,4,4a,9a-tetrahydro-2H-carbazol-1-ylidene)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 90379180 |
| Molecular Formula | C21H24N4S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-[(E)-(6,9-dimethyl-3,4,4a,9a-tetrahydro-2H-carbazol-1-ylidene)amino]-3-phenylthiourea |
| SMILES | Cc1ccc2c(c1)C1CCC/C(=N\NC(=S)Nc3ccccc3)C1N2C |
| InChI | InChI=1S/C21H24N4S/c1-14-11-12-19-17(13-14)16-9-6-10-18(20(16)25(19)2)23-24-21(26)22-15-7-4-3-5-8-15/h3-5,7-8,11-13,16,20H,6,9-10H2,1-2H3,(H2,22,24,26)/b23-18+ |
| InChIKey | WHUOTHNWXQGESF-PTGBLXJZSA-N |
| XLogP | 4.42 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|