C27H26F2N4S — CID 52953126
1-[[2,4-bis(4-fluorophenyl)-3-azabicyclo[3.3.1]nonan-9-ylidene]amino]-3-phenylthiourea (PubChem CID 52953126) has the molecular formula C27H26F2N4S and a molecular weight of 476.60 g/mol. Its IUPAC name is 1-[[2,4-bis(4-fluorophenyl)-3-azabicyclo[3.3.1]nonan-9-ylidene]amino]-3-phenylthiourea.
| Compound Name | 1-[[2,4-bis(4-fluorophenyl)-3-azabicyclo[3.3.1]nonan-9-ylidene]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 52953126 |
| Molecular Formula | C27H26F2N4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1-[[2,4-bis(4-fluorophenyl)-3-azabicyclo[3.3.1]nonan-9-ylidene]amino]-3-phenylthiourea |
| SMILES | Fc1ccc(C2NC(c3ccc(F)cc3)C3CCCC2C3=NNC(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26F2N4S/c28-19-13-9-17(10-14-19)24-22-7-4-8-23(25(31-24)18-11-15-20(29)16-12-18)26(22)32-33-27(34)30-21-5-2-1-3-6-21/h1-3,5-6,9-16,22-25,31H,4,7-8H2,(H2,30,33,34) |
| InChIKey | XRJZHLVCOBNMPM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|