C14H17FN2S — CID 914747
1-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]-3-(4-fluorophenyl)thiourea (PubChem CID 914747) has the molecular formula C14H17FN2S and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 914747 |
| Molecular Formula | C14H17FN2S |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]-3-(4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)NC2[C@H]3CCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C14H17FN2S/c15-9-5-7-10(8-6-9)16-14(18)17-13-11-3-1-2-4-12(11)13/h5-8,11-13H,1-4H2,(H2,16,17,18)/t11-,12+,13? |
| InChIKey | PLHOPFVIYOMFAG-FUNVUKJBSA-N |
| XLogP | 3.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|