C14H19FN3S+ — CID 8762589
1-[(3S)-1-azoniabicyclo[2.2.2]octan-3-yl]-3-(4-fluorophenyl)thiourea (PubChem CID 8762589) has the molecular formula C14H19FN3S+ and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-[(3S)-1-azoniabicyclo[2.2.2]octan-3-yl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(3S)-1-azoniabicyclo[2.2.2]octan-3-yl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 8762589 |
| Molecular Formula | C14H19FN3S+ |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-[(3S)-1-azoniabicyclo[2.2.2]octan-3-yl]-3-(4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)N[C@@H]2C[NH+]3CCC2CC3)cc1 |
| InChI | InChI=1S/C14H18FN3S/c15-11-1-3-12(4-2-11)16-14(19)17-13-9-18-7-5-10(13)6-8-18/h1-4,10,13H,5-9H2,(H2,16,17,19)/p+1/t13-/m1/s1 |
| InChIKey | VWTQDPWGDUXLCK-CYBMUJFWSA-O |
| XLogP | 0.79 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|