C15H21FN2S — CID 11922926
1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(4-fluorophenyl)thiourea (PubChem CID 11922926) has the molecular formula C15H21FN2S and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 11922926 |
| Molecular Formula | C15H21FN2S |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(4-fluorophenyl)thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN2S/c1-10-4-3-5-14(11(10)2)18-15(19)17-13-8-6-12(16)7-9-13/h6-11,14H,3-5H2,1-2H3,(H2,17,18,19)/t10-,11-,14-/m1/s1 |
| InChIKey | HDVXYNKRVGGROH-JTNHKYCSSA-N |
| XLogP | 3.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|