C27H34F2N4S2 — CID 4137701
1-(4-fluorophenyl)-3-[4-[[4-[(4-fluorophenyl)carbamothioylamino]cyclohexyl]methyl]cyclohexyl]thiourea (PubChem CID 4137701) has the molecular formula C27H34F2N4S2 and a molecular weight of 516.73 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[[4-[(4-fluorophenyl)carbamothioylamino]cyclohexyl]methyl]cyclohexyl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[[4-[(4-fluorophenyl)carbamothioylamino]cyclohexyl]methyl]cyclohexyl]thiourea |
|---|---|
| PubChem CID | 4137701 |
| Molecular Formula | C27H34F2N4S2 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[[4-[(4-fluorophenyl)carbamothioylamino]cyclohexyl]methyl]cyclohexyl]thiourea |
| SMILES | Fc1ccc(NC(=S)NC2CCC(CC3CCC(NC(=S)Nc4ccc(F)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H34F2N4S2/c28-20-5-13-24(14-6-20)32-26(34)30-22-9-1-18(2-10-22)17-19-3-11-23(12-4-19)31-27(35)33-25-15-7-21(29)8-16-25/h5-8,13-16,18-19,22-23H,1-4,9-12,17H2,(H2,30,32,34)(H2,31,33,35) |
| InChIKey | NNUDKPLKHCGAFO-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|