C32H36N4S — CID 11398087
1-[(Z)-[(6R,7R)-6,7-diphenyl-4-piperidin-1-yl-2-bicyclo[2.2.2]octanylidene]amino]-3-phenylthiourea (PubChem CID 11398087) has the molecular formula C32H36N4S and a molecular weight of 508.74 g/mol. Its IUPAC name is 1-[(Z)-[(6R,7R)-6,7-diphenyl-4-piperidin-1-yl-2-bicyclo[2.2.2]octanylidene]amino]-3-phenylthiourea.
| Compound Name | 1-[(Z)-[(6R,7R)-6,7-diphenyl-4-piperidin-1-yl-2-bicyclo[2.2.2]octanylidene]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 11398087 |
| Molecular Formula | C32H36N4S |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 1-[(Z)-[(6R,7R)-6,7-diphenyl-4-piperidin-1-yl-2-bicyclo[2.2.2]octanylidene]amino]-3-phenylthiourea |
| SMILES | S=C(N/N=C1/CC2(N3CCCCC3)C[C@@H](c3ccccc3)C1[C@H](c1ccccc1)C2)Nc1ccccc1 |
| InChI | InChI=1S/C32H36N4S/c37-31(33-26-17-9-3-10-18-26)35-34-29-23-32(36-19-11-4-12-20-36)21-27(24-13-5-1-6-14-24)30(29)28(22-32)25-15-7-2-8-16-25/h1-3,5-10,13-18,27-28,30H,4,11-12,19-23H2,(H2,33,35,37)/b34-29-/t27-,28-,30?,32?/m0/s1 |
| InChIKey | ZLNTWDQXNAQWDN-XDLVGVSHSA-N |
| XLogP | 6.93 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|