C25H31NO — CID 16726334
(2R,6R,7S)-6,7-diphenyl-4-piperidin-1-ylbicyclo[2.2.2]octan-2-ol (PubChem CID 16726334) has the molecular formula C25H31NO and a molecular weight of 361.53 g/mol. Its IUPAC name is (2R,6R,7S)-6,7-diphenyl-4-piperidin-1-ylbicyclo[2.2.2]octan-2-ol.
| Compound Name | (2R,6R,7S)-6,7-diphenyl-4-piperidin-1-ylbicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 16726334 |
| Molecular Formula | C25H31NO |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (2R,6R,7S)-6,7-diphenyl-4-piperidin-1-ylbicyclo[2.2.2]octan-2-ol |
| SMILES | O[C@@H]1CC2(N3CCCCC3)C[C@H](c3ccccc3)C1[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C25H31NO/c27-23-18-25(26-14-8-3-9-15-26)16-21(19-10-4-1-5-11-19)24(23)22(17-25)20-12-6-2-7-13-20/h1-2,4-7,10-13,21-24,27H,3,8-9,14-18H2/t21-,22+,23-,24?,25?/m1/s1 |
| InChIKey | ZYCCDGNCYIZABH-HTOMHKFXSA-N |
| XLogP | 4.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |