C26H33NO3 — CID 11315779
(6R,7R)-6,7-bis(4-methoxyphenyl)-4-pyrrolidin-1-ylbicyclo[2.2.2]octan-2-ol (PubChem CID 11315779) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is (6R,7R)-6,7-bis(4-methoxyphenyl)-4-pyrrolidin-1-ylbicyclo[2.2.2]octan-2-ol.
| Compound Name | (6R,7R)-6,7-bis(4-methoxyphenyl)-4-pyrrolidin-1-ylbicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 11315779 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (6R,7R)-6,7-bis(4-methoxyphenyl)-4-pyrrolidin-1-ylbicyclo[2.2.2]octan-2-ol |
| SMILES | COc1ccc([C@@H]2CC3(N4CCCC4)CC(O)C2[C@H](c2ccc(OC)cc2)C3)cc1 |
| InChI | InChI=1S/C26H33NO3/c1-29-20-9-5-18(6-10-20)22-15-26(27-13-3-4-14-27)16-23(25(22)24(28)17-26)19-7-11-21(30-2)12-8-19/h5-12,22-25,28H,3-4,13-17H2,1-2H3/t22-,23-,24?,25?,26?/m0/s1 |
| InChIKey | HWQISLZWCOZLRA-GVABRVPGSA-N |
| XLogP | 4.58 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |