C19H20N4O2S — CID 27331592
2-[(1S,2Z)-2-(phenylcarbamothioylhydrazinylidene)cyclohexyl]pyridine-4-carboxylic acid (PubChem CID 27331592) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[(1S,2Z)-2-(phenylcarbamothioylhydrazinylidene)cyclohexyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(1S,2Z)-2-(phenylcarbamothioylhydrazinylidene)cyclohexyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 27331592 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[(1S,2Z)-2-(phenylcarbamothioylhydrazinylidene)cyclohexyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc([C@@H]2CCCC/C2=N/NC(=S)Nc2ccccc2)c1 |
| InChI | InChI=1S/C19H20N4O2S/c24-18(25)13-10-11-20-17(12-13)15-8-4-5-9-16(15)22-23-19(26)21-14-6-2-1-3-7-14/h1-3,6-7,10-12,15H,4-5,8-9H2,(H,24,25)(H2,21,23,26)/b22-16-/t15-/m1/s1 |
| InChIKey | DNRABLMEJVUCPH-QJIFYWSCSA-N |
| XLogP | 3.78 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|