C19H18ClN3O3 — CID 27331603
2-[(1R,2Z)-2-[(2-chlorobenzoyl)hydrazinylidene]cyclohexyl]pyridine-4-carboxylic acid (PubChem CID 27331603) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is 2-[(1R,2Z)-2-[(2-chlorobenzoyl)hydrazinylidene]cyclohexyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(1R,2Z)-2-[(2-chlorobenzoyl)hydrazinylidene]cyclohexyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 27331603 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-[(1R,2Z)-2-[(2-chlorobenzoyl)hydrazinylidene]cyclohexyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc([C@H]2CCCC/C2=N/NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H18ClN3O3/c20-15-7-3-1-5-13(15)18(24)23-22-16-8-4-2-6-14(16)17-11-12(19(25)26)9-10-21-17/h1,3,5,7,9-11,14H,2,4,6,8H2,(H,23,24)(H,25,26)/b22-16-/t14-/m0/s1 |
| InChIKey | ODDQEWDZHIGXPT-DJFNHCPNSA-N |
| XLogP | 3.88 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|