C18H18N4OS — CID 175010049
1-[(1-acetyl-2,3-dihydroquinolin-4-ylidene)amino]-3-phenylthiourea (PubChem CID 175010049) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 1-[(1-acetyl-2,3-dihydroquinolin-4-ylidene)amino]-3-phenylthiourea.
| Compound Name | 1-[(1-acetyl-2,3-dihydroquinolin-4-ylidene)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 175010049 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[(1-acetyl-2,3-dihydroquinolin-4-ylidene)amino]-3-phenylthiourea |
| SMILES | CC(=O)N1CCC(=NNC(=S)Nc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H18N4OS/c1-13(23)22-12-11-16(15-9-5-6-10-17(15)22)20-21-18(24)19-14-7-3-2-4-8-14/h2-10H,11-12H2,1H3,(H2,19,21,24) |
| InChIKey | LVBNKNONTJLWOO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|