C18H25N5S — CID 6386368
1-[(E)-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-phenylthiourea (PubChem CID 6386368) has the molecular formula C18H25N5S and a molecular weight of 343.50 g/mol. Its IUPAC name is 1-[(E)-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-phenylthiourea.
| Compound Name | 1-[(E)-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 6386368 |
| Molecular Formula | C18H25N5S |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-[(E)-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-phenylthiourea |
| SMILES | CCC12CN3CCN(CC(C3)/C1=N\NC(=S)Nc1ccccc1)C2 |
| InChI | InChI=1S/C18H25N5S/c1-2-18-12-22-8-9-23(13-18)11-14(10-22)16(18)20-21-17(24)19-15-6-4-3-5-7-15/h3-7,14H,2,8-13H2,1H3,(H2,19,21,24)/b20-16+ |
| InChIKey | DQUSUYJHRRGULG-CAPFRKAQSA-N |
| XLogP | 1.99 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|