C16H16N4S2 — CID 3701837
1-[(3-ethyl-1,3-benzothiazol-2-ylidene)amino]-3-phenylthiourea (PubChem CID 3701837) has the molecular formula C16H16N4S2 and a molecular weight of 328.47 g/mol. Its IUPAC name is 1-[(3-ethyl-1,3-benzothiazol-2-ylidene)amino]-3-phenylthiourea.
| Compound Name | 1-[(3-ethyl-1,3-benzothiazol-2-ylidene)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 3701837 |
| Molecular Formula | C16H16N4S2 |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-[(3-ethyl-1,3-benzothiazol-2-ylidene)amino]-3-phenylthiourea |
| SMILES | CCn1c(=NNC(=S)Nc2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C16H16N4S2/c1-2-20-13-10-6-7-11-14(13)22-16(20)19-18-15(21)17-12-8-4-3-5-9-12/h3-11H,2H2,1H3,(H2,17,18,21) |
| InChIKey | NBBBVLGHZXSDGE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|