C18H20ClN5O3S2 — CID 20580372
1-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-[(E)-(3-ethyl-1,3-benzothiazol-2-ylidene)amino]urea (PubChem CID 20580372) has the molecular formula C18H20ClN5O3S2 and a molecular weight of 453.98 g/mol. Its IUPAC name is 1-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-[(E)-(3-ethyl-1,3-benzothiazol-2-ylidene)amino]urea.
| Compound Name | 1-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-[(E)-(3-ethyl-1,3-benzothiazol-2-ylidene)amino]urea |
|---|---|
| PubChem CID | 20580372 |
| Molecular Formula | C18H20ClN5O3S2 |
| Molecular Weight | 453.98 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 1-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-[(E)-(3-ethyl-1,3-benzothiazol-2-ylidene)amino]urea |
| SMILES | CCn1/c(=N\NC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2Cl)sc2ccccc21 |
| InChI | InChI=1S/C18H20ClN5O3S2/c1-4-24-15-7-5-6-8-16(15)28-18(24)22-21-17(25)20-14-11-12(9-10-13(14)19)29(26,27)23(2)3/h5-11H,4H2,1-3H3,(H2,20,21,25)/b22-18+ |
| InChIKey | NBBYUTZNWXUHSO-RELWKKBWSA-N |
| XLogP | 3.26 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.98 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|