C19H22N6S2 — CID 14325233
1-phenyl-3-[(E)-[(2E)-2-(phenylcarbamothioylhydrazinylidene)pentan-3-ylidene]amino]thiourea (PubChem CID 14325233) has the molecular formula C19H22N6S2 and a molecular weight of 398.56 g/mol. Its IUPAC name is 1-phenyl-3-[(E)-[(2E)-2-(phenylcarbamothioylhydrazinylidene)pentan-3-ylidene]amino]thiourea.
| Compound Name | 1-phenyl-3-[(E)-[(2E)-2-(phenylcarbamothioylhydrazinylidene)pentan-3-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 14325233 |
| Molecular Formula | C19H22N6S2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-phenyl-3-[(E)-[(2E)-2-(phenylcarbamothioylhydrazinylidene)pentan-3-ylidene]amino]thiourea |
| SMILES | CCC(=N\NC(=S)Nc1ccccc1)/C(C)=N/NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C19H22N6S2/c1-3-17(23-25-19(27)21-16-12-8-5-9-13-16)14(2)22-24-18(26)20-15-10-6-4-7-11-15/h4-13H,3H2,1-2H3,(H2,20,24,26)(H2,21,25,27)/b22-14+,23-17+ |
| InChIKey | ATOFKZHGOBXESW-IXVRPATCSA-N |
| XLogP | 4.10 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|