C9H10N4S2 — CID 798473
[(3-methyl-1,3-benzothiazol-2-ylidene)amino]thiourea (PubChem CID 798473) has the molecular formula C9H10N4S2 and a molecular weight of 238.34 g/mol. Its IUPAC name is [(3-methyl-1,3-benzothiazol-2-ylidene)amino]thiourea.
| Compound Name | [(3-methyl-1,3-benzothiazol-2-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 798473 |
| Molecular Formula | C9H10N4S2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | [(3-methyl-1,3-benzothiazol-2-ylidene)amino]thiourea |
| SMILES | Cn1c(=NNC(N)=S)sc2ccccc21 |
| InChI | InChI=1S/C9H10N4S2/c1-13-6-4-2-3-5-7(6)15-9(13)12-11-8(10)14/h2-5H,1H3,(H3,10,11,14) |
| InChIKey | RVSMJVNXHSMKRF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|