C15H12FN3OS — CID 6900936
2-fluoro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide (PubChem CID 6900936) has the molecular formula C15H12FN3OS and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-fluoro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide.
| Compound Name | 2-fluoro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 6900936 |
| Molecular Formula | C15H12FN3OS |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-fluoro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide |
| SMILES | Cn1/c(=N/NC(=O)c2ccccc2F)sc2ccccc21 |
| InChI | InChI=1S/C15H12FN3OS/c1-19-12-8-4-5-9-13(12)21-15(19)18-17-14(20)10-6-2-3-7-11(10)16/h2-9H,1H3,(H,17,20)/b18-15- |
| InChIKey | LFQVGKLEZVKKKR-SDXDJHTJSA-N |
| XLogP | 2.62 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|