C15H11N5O5S — CID 6998819
N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2,4-dinitrobenzamide (PubChem CID 6998819) has the molecular formula C15H11N5O5S and a molecular weight of 373.35 g/mol. Its IUPAC name is N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2,4-dinitrobenzamide.
| Compound Name | N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 6998819 |
| Molecular Formula | C15H11N5O5S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2,4-dinitrobenzamide |
| SMILES | Cn1/c(=N/NC(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])sc2ccccc21 |
| InChI | InChI=1S/C15H11N5O5S/c1-18-11-4-2-3-5-13(11)26-15(18)17-16-14(21)10-7-6-9(19(22)23)8-12(10)20(24)25/h2-8H,1H3,(H,16,21)/b17-15- |
| InChIKey | ZDBMYTDIOWYZCM-ICFOKQHNSA-N |
| XLogP | 2.30 |
| TPSA | 132.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|