C19H15N5O5S — CID 42989921
N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 42989921) has the molecular formula C19H15N5O5S and a molecular weight of 425.43 g/mol. Its IUPAC name is N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 42989921 |
| Molecular Formula | C19H15N5O5S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC(C(=O)N/N=c1/sc2ccccc2n1C)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C19H15N5O5S/c1-10(16(25)20-21-19-22(2)12-7-3-4-9-14(12)30-19)23-17(26)11-6-5-8-13(24(28)29)15(11)18(23)27/h3-10H,1-2H3,(H,20,25)/b21-19+ |
| InChIKey | GWCSTKZODOGZPC-XUTLUUPISA-N |
| XLogP | 1.76 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|