C12H12N4O3S — CID 129431705
cis-(1S,2R)-N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-nitrocyclopropane-1-carboxamide (PubChem CID 129431705) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is cis-(1S,2R)-N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129431705 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | cis-(1S,2R)-N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-nitrocyclopropane-1-carboxamide |
| SMILES | Cn1c(=NNC(=O)[C@H]2C[C@H]2[N+](=O)[O-])sc2ccccc21 |
| InChI | InChI=1S/C12H12N4O3S/c1-15-8-4-2-3-5-10(8)20-12(15)14-13-11(17)7-6-9(7)16(18)19/h2-5,7,9H,6H2,1H3,(H,13,17)/t7-,9+/m0/s1 |
| InChIKey | OJLCJUQOQZKPJI-IONNQARKSA-N |
| XLogP | 0.84 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|