C12H12N4OS — CID 98433969
1-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-prop-2-ynylurea (PubChem CID 98433969) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 1-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-prop-2-ynylurea.
| Compound Name | 1-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 98433969 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)N/N=c1/sc2ccccc2n1C |
| InChI | InChI=1S/C12H12N4OS/c1-3-8-13-11(17)14-15-12-16(2)9-6-4-5-7-10(9)18-12/h1,4-7H,8H2,2H3,(H2,13,14,17)/b15-12+ |
| InChIKey | WQPANEVXWLBTLA-NTCAYCPXSA-N |
| XLogP | 0.99 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|