C19H20N4O2S — CID 43054265
N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-[(2-phenylacetyl)amino]propanamide (PubChem CID 43054265) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-[(2-phenylacetyl)amino]propanamide.
| Compound Name | N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-[(2-phenylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 43054265 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-[(2-phenylacetyl)amino]propanamide |
| SMILES | Cn1/c(=N/NC(=O)CCNC(=O)Cc2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C19H20N4O2S/c1-23-15-9-5-6-10-16(15)26-19(23)22-21-17(24)11-12-20-18(25)13-14-7-3-2-4-8-14/h2-10H,11-13H2,1H3,(H,20,25)(H,21,24)/b22-19- |
| InChIKey | KMIARJKOLUBKPZ-QOCHGBHMSA-N |
| XLogP | 1.92 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|