C18H16F2N4O2S — CID 43054267
2,4-difluoro-N-[3-[(2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinyl]-3-oxopropyl]benzamide (PubChem CID 43054267) has the molecular formula C18H16F2N4O2S and a molecular weight of 390.42 g/mol. Its IUPAC name is 2,4-difluoro-N-[3-[(2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinyl]-3-oxopropyl]benzamide.
| Compound Name | 2,4-difluoro-N-[3-[(2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 43054267 |
| Molecular Formula | C18H16F2N4O2S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2,4-difluoro-N-[3-[(2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinyl]-3-oxopropyl]benzamide |
| SMILES | Cn1/c(=N/NC(=O)CCNC(=O)c2ccc(F)cc2F)sc2ccccc21 |
| InChI | InChI=1S/C18H16F2N4O2S/c1-24-14-4-2-3-5-15(14)27-18(24)23-22-16(25)8-9-21-17(26)12-7-6-11(19)10-13(12)20/h2-7,10H,8-9H2,1H3,(H,21,26)(H,22,25)/b23-18- |
| InChIKey | IFRLYYWLFWNJIX-NKFKGCMQSA-N |
| XLogP | 2.27 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|