C18H19N3O2S — CID 7928957
N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-(4-methylphenoxy)propanamide (PubChem CID 7928957) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-(4-methylphenoxy)propanamide.
| Compound Name | N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-(4-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 7928957 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-3-(4-methylphenoxy)propanamide |
| SMILES | Cc1ccc(OCCC(=O)N/N=c2/sc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-13-7-9-14(10-8-13)23-12-11-17(22)19-20-18-21(2)15-5-3-4-6-16(15)24-18/h3-10H,11-12H2,1-2H3,(H,19,22)/b20-18+ |
| InChIKey | GNXNTMODPDYXLK-CZIZESTLSA-N |
| XLogP | 2.95 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|