C11H13N3O2S — CID 6013283
ethyl N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]carbamate (PubChem CID 6013283) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is ethyl N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]carbamate.
| Compound Name | ethyl N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]carbamate |
|---|---|
| PubChem CID | 6013283 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | ethyl N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]carbamate |
| SMILES | CCOC(=O)N/N=c1\sc2ccccc2n1C |
| InChI | InChI=1S/C11H13N3O2S/c1-3-16-11(15)13-12-10-14(2)8-6-4-5-7-9(8)17-10/h4-7H,3H2,1-2H3,(H,13,15)/b12-10- |
| InChIKey | ZEDVLFMBPNIZSF-BENRWUELSA-N |
| XLogP | 1.80 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|