C13H9Cl2N3OS2 — CID 7087730
2,5-dichloro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]thiophene-3-carboxamide (PubChem CID 7087730) has the molecular formula C13H9Cl2N3OS2 and a molecular weight of 358.28 g/mol. Its IUPAC name is 2,5-dichloro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 7087730 |
| Molecular Formula | C13H9Cl2N3OS2 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 2,5-dichloro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]thiophene-3-carboxamide |
| SMILES | Cn1/c(=N/NC(=O)c2cc(Cl)sc2Cl)sc2ccccc21 |
| InChI | InChI=1S/C13H9Cl2N3OS2/c1-18-8-4-2-3-5-9(8)20-13(18)17-16-12(19)7-6-10(14)21-11(7)15/h2-6H,1H3,(H,16,19)/b17-13- |
| InChIKey | VPVYYXLSZYUUSG-LGMDPLHJSA-N |
| XLogP | 3.85 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|