C19H21N5O2S — CID 60550796
N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(propan-2-ylcarbamoylamino)benzamide (PubChem CID 60550796) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(propan-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(propan-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 60550796 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(propan-2-ylcarbamoylamino)benzamide |
| SMILES | CC(C)NC(=O)Nc1ccccc1C(=O)N/N=c1/sc2ccccc2n1C |
| InChI | InChI=1S/C19H21N5O2S/c1-12(2)20-18(26)21-14-9-5-4-8-13(14)17(25)22-23-19-24(3)15-10-6-7-11-16(15)27-19/h4-12H,1-3H3,(H,22,25)(H2,20,21,26)/b23-19+ |
| InChIKey | VGHOBGOOFLAOCN-FCDQGJHFSA-N |
| XLogP | 3.02 |
| TPSA | 87.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|