C19H20N4O3S2 — CID 6002872
N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 6002872) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 6002872 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | Cn1/c(=N\NC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)sc2ccccc21 |
| InChI | InChI=1S/C19H20N4O3S2/c1-22-16-6-2-3-7-17(16)27-19(22)21-20-18(24)14-8-10-15(11-9-14)28(25,26)23-12-4-5-13-23/h2-3,6-11H,4-5,12-13H2,1H3,(H,20,24)/b21-19+ |
| InChIKey | ZJXLSRSRQMKJLW-XUTLUUPISA-N |
| XLogP | 2.27 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|