C15H11Cl2N3OS — CID 2354326
2,3-dichloro-N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide (PubChem CID 2354326) has the molecular formula C15H11Cl2N3OS and a molecular weight of 352.25 g/mol. Its IUPAC name is 2,3-dichloro-N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide.
| Compound Name | 2,3-dichloro-N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 2354326 |
| Molecular Formula | C15H11Cl2N3OS |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2,3-dichloro-N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide |
| SMILES | Cn1c(=NNC(=O)c2cccc(Cl)c2Cl)sc2ccccc21 |
| InChI | InChI=1S/C15H11Cl2N3OS/c1-20-11-7-2-3-8-12(11)22-15(20)19-18-14(21)9-5-4-6-10(16)13(9)17/h2-8H,1H3,(H,18,21) |
| InChIKey | FZNVHKVMBPNMCI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|