C20H20N4O2S — CID 60550823
2-[cyclopropanecarbonyl(methyl)amino]-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide (PubChem CID 60550823) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[cyclopropanecarbonyl(methyl)amino]-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide.
| Compound Name | 2-[cyclopropanecarbonyl(methyl)amino]-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 60550823 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-[cyclopropanecarbonyl(methyl)amino]-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]benzamide |
| SMILES | CN(C(=O)C1CC1)c1ccccc1C(=O)N/N=c1/sc2ccccc2n1C |
| InChI | InChI=1S/C20H20N4O2S/c1-23(19(26)13-11-12-13)15-8-4-3-7-14(15)18(25)21-22-20-24(2)16-9-5-6-10-17(16)27-20/h3-10,13H,11-12H2,1-2H3,(H,21,25)/b22-20+ |
| InChIKey | VNPNTVXKOLNCDA-LSDHQDQOSA-N |
| XLogP | 2.86 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|