C16H12ClN7OS — CID 46438770
5-chloro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(tetrazol-1-yl)benzamide (PubChem CID 46438770) has the molecular formula C16H12ClN7OS and a molecular weight of 385.84 g/mol. Its IUPAC name is 5-chloro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(tetrazol-1-yl)benzamide.
| Compound Name | 5-chloro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 46438770 |
| Molecular Formula | C16H12ClN7OS |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 5-chloro-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(tetrazol-1-yl)benzamide |
| SMILES | Cn1/c(=N/NC(=O)c2cc(Cl)ccc2-n2cnnn2)sc2ccccc21 |
| InChI | InChI=1S/C16H12ClN7OS/c1-23-13-4-2-3-5-14(13)26-16(23)20-19-15(25)11-8-10(17)6-7-12(11)24-9-18-21-22-24/h2-9H,1H3,(H,19,25)/b20-16- |
| InChIKey | ROXOCIYLLOISGX-SILNSSARSA-N |
| XLogP | 2.11 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|