C17H18N4O3S2 — CID 78828217
3,4-dimethyl-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-5-sulfamoylbenzamide (PubChem CID 78828217) has the molecular formula C17H18N4O3S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-5-sulfamoylbenzamide.
| Compound Name | 3,4-dimethyl-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 78828217 |
| Molecular Formula | C17H18N4O3S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 3,4-dimethyl-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C(=O)N/N=c2/sc3ccccc3n2C)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C17H18N4O3S2/c1-10-8-12(9-15(11(10)2)26(18,23)24)16(22)19-20-17-21(3)13-6-4-5-7-14(13)25-17/h4-9H,1-3H3,(H,19,22)(H2,18,23,24)/b20-17+ |
| InChIKey | SOPDYMFQYZUENN-LVZFUZTISA-N |
| XLogP | 1.75 |
| TPSA | 106.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|