C17H15N5O2S2 — CID 51229719
3,5-dimethyl-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-4-oxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 51229719) has the molecular formula C17H15N5O2S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-4-oxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 3,5-dimethyl-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 51229719 |
| Molecular Formula | C17H15N5O2S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 3,5-dimethyl-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)N/N=c2/sc3ccccc3n2C)sc2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C17H15N5O2S2/c1-9-12-15(18-8-21(2)16(12)24)26-13(9)14(23)19-20-17-22(3)10-6-4-5-7-11(10)25-17/h4-8H,1-3H3,(H,19,23)/b20-17+ |
| InChIKey | STEJOVXIFXLYIB-LVZFUZTISA-N |
| XLogP | 2.10 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|