C20H21N5O2S — CID 51231452
3,5-dimethyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 51231452) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 3,5-dimethyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 3,5-dimethyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 51231452 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 3,5-dimethyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCCn2c(C)nc3ccccc32)sc2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C20H21N5O2S/c1-12-16-19(22-11-24(3)20(16)27)28-17(12)18(26)21-9-6-10-25-13(2)23-14-7-4-5-8-15(14)25/h4-5,7-8,11H,6,9-10H2,1-3H3,(H,21,26) |
| InChIKey | JSYLBLJOURTELY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|