C13H14F3N3O2S — CID 98574529
(2R)-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 98574529) has the molecular formula C13H14F3N3O2S and a molecular weight of 333.34 g/mol. Its IUPAC name is (2R)-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | (2R)-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 98574529 |
| Molecular Formula | C13H14F3N3O2S |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (2R)-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | C[C@@H](OCC(F)(F)F)C(=O)N/N=c1\sc2ccccc2n1C |
| InChI | InChI=1S/C13H14F3N3O2S/c1-8(21-7-13(14,15)16)11(20)17-18-12-19(2)9-5-3-4-6-10(9)22-12/h3-6,8H,7H2,1-2H3,(H,17,20)/b18-12-/t8-/m1/s1 |
| InChIKey | OQFFUZPJAKOUMW-RMKINNOESA-N |
| XLogP | 2.14 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|